C44H39BBr2N2O5 — CID 139777911
bis(1-(4-bromophenoxy)pyridin-1-ium);dioxido(4,4,4-triphenylbutoxy)borane (PubChem CID 139777911) has the molecular formula C44H39BBr2N2O5 and a molecular weight of 846.43 g/mol. Its IUPAC name is bis(1-(4-bromophenoxy)pyridin-1-ium);dioxido(4,4,4-triphenylbutoxy)borane.
| Compound Name | bis(1-(4-bromophenoxy)pyridin-1-ium);dioxido(4,4,4-triphenylbutoxy)borane |
|---|---|
| PubChem CID | 139777911 |
| Molecular Formula | C44H39BBr2N2O5 |
| Molecular Weight | 846.43 g/mol |
| Exact Mass | 844.13 |
| IUPAC Name | bis(1-(4-bromophenoxy)pyridin-1-ium);dioxido(4,4,4-triphenylbutoxy)borane |
| SMILES | Brc1ccc(O[n+]2ccccc2)cc1.Brc1ccc(O[n+]2ccccc2)cc1.[O-]B([O-])OCCCC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H21BO3.2C11H9BrNO/c24-23(25)26-18-10-17-22(19-11-4-1-5-12-19,20-13-6-2-7-14-20)21-15-8-3-9-16-21;2*12-10-4-6-11(7-5-10)14-13-8-2-1-3-9-13/h1-9,11-16H,10,17-18H2;2*1-9H/q-2;2*+1 |
| InChIKey | XUDUMAZJYXIJIP-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 81.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 846.43 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|