C68H89BN2O7 — CID 139777897
bis(2-(4-decylphenoxy)-1-ethoxypyridin-1-ium);dioxido(4,4,4-triphenylbutoxy)borane (PubChem CID 139777897) has the molecular formula C68H89BN2O7 and a molecular weight of 1057.28 g/mol. Its IUPAC name is bis(2-(4-decylphenoxy)-1-ethoxypyridin-1-ium);dioxido(4,4,4-triphenylbutoxy)borane.
| Compound Name | bis(2-(4-decylphenoxy)-1-ethoxypyridin-1-ium);dioxido(4,4,4-triphenylbutoxy)borane |
|---|---|
| PubChem CID | 139777897 |
| Molecular Formula | C68H89BN2O7 |
| Molecular Weight | 1057.28 g/mol |
| Exact Mass | 1056.68 |
| IUPAC Name | bis(2-(4-decylphenoxy)-1-ethoxypyridin-1-ium);dioxido(4,4,4-triphenylbutoxy)borane |
| SMILES | CCCCCCCCCCc1ccc(Oc2cccc[n+]2OCC)cc1.CCCCCCCCCCc1ccc(Oc2cccc[n+]2OCC)cc1.[O-]B([O-])OCCCC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/2C23H34NO2.C22H21BO3/c2*1-3-5-6-7-8-9-10-11-14-21-16-18-22(19-17-21)26-23-15-12-13-20-24(23)25-4-2;24-23(25)26-18-10-17-22(19-11-4-1-5-12-19,20-13-6-2-7-14-20)21-15-8-3-9-16-21/h2*12-13,15-20H,3-11,14H2,1-2H3;1-9,11-16H,10,17-18H2/q2*+1;-2 |
| InChIKey | HRDYLCDOMZMFJH-UHFFFAOYSA-N |
| XLogP | 14.32 |
| TPSA | 100.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1057.28 |
| LogP ≤ 5 | 14.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|