C24H33FN2O — CID 139778926
3-(2-fluoro-4-propoxyphenyl)-6-[2-(4-propylcyclohexyl)ethyl]pyridazine (PubChem CID 139778926) has the molecular formula C24H33FN2O and a molecular weight of 384.54 g/mol. Its IUPAC name is 3-(2-fluoro-4-propoxyphenyl)-6-[2-(4-propylcyclohexyl)ethyl]pyridazine.
| Compound Name | 3-(2-fluoro-4-propoxyphenyl)-6-[2-(4-propylcyclohexyl)ethyl]pyridazine |
|---|---|
| PubChem CID | 139778926 |
| Molecular Formula | C24H33FN2O |
| Molecular Weight | 384.54 g/mol |
| Exact Mass | 384.26 |
| IUPAC Name | 3-(2-fluoro-4-propoxyphenyl)-6-[2-(4-propylcyclohexyl)ethyl]pyridazine |
| SMILES | CCCOc1ccc(-c2ccc(CCC3CCC(CCC)CC3)nn2)c(F)c1 |
| InChI | InChI=1S/C24H33FN2O/c1-3-5-18-6-8-19(9-7-18)10-11-20-12-15-24(27-26-20)22-14-13-21(17-23(22)25)28-16-4-2/h12-15,17-19H,3-11,16H2,1-2H3 |
| InChIKey | UDFPGBFHUMJQQM-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.54 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |