C9H9F4N — CID 139779681
[3,5-bis(difluoromethyl)phenyl]methanamine (PubChem CID 139779681) has the molecular formula C9H9F4N and a molecular weight of 207.17 g/mol. Its IUPAC name is [3,5-bis(difluoromethyl)phenyl]methanamine.
| Compound Name | [3,5-bis(difluoromethyl)phenyl]methanamine |
|---|---|
| PubChem CID | 139779681 |
| Molecular Formula | C9H9F4N |
| Molecular Weight | 207.17 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | [3,5-bis(difluoromethyl)phenyl]methanamine |
| SMILES | NCc1cc(C(F)F)cc(C(F)F)c1 |
| InChI | InChI=1S/C9H9F4N/c10-8(11)6-1-5(4-14)2-7(3-6)9(12)13/h1-3,8-9H,4,14H2 |
| InChIKey | VWJKDWOQVRXQGJ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.17 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |