C14H11Cl9 — CID 139779729
1,1,2,2,3,3,4,4,5-nonachloro-5-(1-phenylethyl)cyclohexane (PubChem CID 139779729) has the molecular formula C14H11Cl9 and a molecular weight of 498.32 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5-nonachloro-5-(1-phenylethyl)cyclohexane.
| Compound Name | 1,1,2,2,3,3,4,4,5-nonachloro-5-(1-phenylethyl)cyclohexane |
|---|---|
| PubChem CID | 139779729 |
| Molecular Formula | C14H11Cl9 |
| Molecular Weight | 498.32 g/mol |
| Exact Mass | 493.81 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5-nonachloro-5-(1-phenylethyl)cyclohexane |
| SMILES | CC(c1ccccc1)C1(Cl)CC(Cl)(Cl)C(Cl)(Cl)C(Cl)(Cl)C1(Cl)Cl |
| InChI | InChI=1S/C14H11Cl9/c1-8(9-5-3-2-4-6-9)10(15)7-11(16,17)13(20,21)14(22,23)12(10,18)19/h2-6,8H,7H2,1H3 |
| InChIKey | RAWJCTZANWDYBE-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.32 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|