C15H22 — CID 139768950
1-(1-methylcyclohexyl)ethylbenzene (PubChem CID 139768950) has the molecular formula C15H22 and a molecular weight of 202.34 g/mol. Its IUPAC name is 1-(1-methylcyclohexyl)ethylbenzene.
| Compound Name | 1-(1-methylcyclohexyl)ethylbenzene |
|---|---|
| PubChem CID | 139768950 |
| Molecular Formula | C15H22 |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | 1-(1-methylcyclohexyl)ethylbenzene |
| SMILES | CC(c1ccccc1)C1(C)CCCCC1 |
| InChI | InChI=1S/C15H22/c1-13(14-9-5-3-6-10-14)15(2)11-7-4-8-12-15/h3,5-6,9-10,13H,4,7-8,11-12H2,1-2H3 |
| InChIKey | NQAMEBTWRMXLDZ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |