C19H28N2O — CID 15350128
2,2-dimethyl-4-[(1S)-1-phenylethyl]-1,4-diazaspiro[5.5]undecan-5-one (PubChem CID 15350128) has the molecular formula C19H28N2O and a molecular weight of 300.45 g/mol. Its IUPAC name is 2,2-dimethyl-4-[(1S)-1-phenylethyl]-1,4-diazaspiro[5.5]undecan-5-one.
| Compound Name | 2,2-dimethyl-4-[(1S)-1-phenylethyl]-1,4-diazaspiro[5.5]undecan-5-one |
|---|---|
| PubChem CID | 15350128 |
| Molecular Formula | C19H28N2O |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.22 |
| IUPAC Name | 2,2-dimethyl-4-[(1S)-1-phenylethyl]-1,4-diazaspiro[5.5]undecan-5-one |
| SMILES | C[C@@H](c1ccccc1)N1CC(C)(C)NC2(CCCCC2)C1=O |
| InChI | InChI=1S/C19H28N2O/c1-15(16-10-6-4-7-11-16)21-14-18(2,3)20-19(17(21)22)12-8-5-9-13-19/h4,6-7,10-11,15,20H,5,8-9,12-14H2,1-3H3/t15-/m0/s1 |
| InChIKey | GKPUVEXHIMUGFF-HNNXBMFYSA-N |
| XLogP | 3.66 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |