C34H44F2N2O2 — CID 159987435
(3R,4S)-3-fluoro-4-(1-methylcyclobutyl)-1-[(1S)-1-phenylethyl]pyrrolidin-2-one (PubChem CID 159987435) has the molecular formula C34H44F2N2O2 and a molecular weight of 550.73 g/mol. Its IUPAC name is (3R,4S)-3-fluoro-4-(1-methylcyclobutyl)-1-[(1S)-1-phenylethyl]pyrrolidin-2-one.
| Compound Name | (3R,4S)-3-fluoro-4-(1-methylcyclobutyl)-1-[(1S)-1-phenylethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 159987435 |
| Molecular Formula | C34H44F2N2O2 |
| Molecular Weight | 550.73 g/mol |
| Exact Mass | 550.34 |
| IUPAC Name | (3R,4S)-3-fluoro-4-(1-methylcyclobutyl)-1-[(1S)-1-phenylethyl]pyrrolidin-2-one |
| SMILES | C[C@@H](c1ccccc1)N1C[C@H](C2(C)CCC2)[C@@H](F)C1=O.C[C@@H](c1ccccc1)N1C[C@H](C2(C)CCC2)[C@@H](F)C1=O |
| InChI | InChI=1S/2C17H22FNO/c2*1-12(13-7-4-3-5-8-13)19-11-14(15(18)16(19)20)17(2)9-6-10-17/h2*3-5,7-8,12,14-15H,6,9-11H2,1-2H3/t2*12-,14-,15+/m00/s1 |
| InChIKey | OGNALJQUKHMQNB-RHRUPGIJSA-N |
| XLogP | 7.47 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.73 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |