C12H22N2O — CID 139780446
5-ethyl-1-N-(2-methoxyethyl)-5-methylcyclohexa-1,3-diene-1,4-diamine (PubChem CID 139780446) has the molecular formula C12H22N2O and a molecular weight of 210.32 g/mol. Its IUPAC name is 5-ethyl-1-N-(2-methoxyethyl)-5-methylcyclohexa-1,3-diene-1,4-diamine.
| Compound Name | 5-ethyl-1-N-(2-methoxyethyl)-5-methylcyclohexa-1,3-diene-1,4-diamine |
|---|---|
| PubChem CID | 139780446 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | 5-ethyl-1-N-(2-methoxyethyl)-5-methylcyclohexa-1,3-diene-1,4-diamine |
| SMILES | CCC1(C)CC(NCCOC)=CC=C1N |
| InChI | InChI=1S/C12H22N2O/c1-4-12(2)9-10(5-6-11(12)13)14-7-8-15-3/h5-6,14H,4,7-9,13H2,1-3H3 |
| InChIKey | NUJCZEVTJMGZNA-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|