C20H28Cl2O5 — CID 139781072
7-[4-(carboxymethoxy)phenyl]-2,2-dichlorododecanoic acid (PubChem CID 139781072) has the molecular formula C20H28Cl2O5 and a molecular weight of 419.35 g/mol. Its IUPAC name is 7-[4-(carboxymethoxy)phenyl]-2,2-dichlorododecanoic acid.
| Compound Name | 7-[4-(carboxymethoxy)phenyl]-2,2-dichlorododecanoic acid |
|---|---|
| PubChem CID | 139781072 |
| Molecular Formula | C20H28Cl2O5 |
| Molecular Weight | 419.35 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | 7-[4-(carboxymethoxy)phenyl]-2,2-dichlorododecanoic acid |
| SMILES | CCCCCC(CCCCC(Cl)(Cl)C(=O)O)c1ccc(OCC(=O)O)cc1 |
| InChI | InChI=1S/C20H28Cl2O5/c1-2-3-4-7-15(8-5-6-13-20(21,22)19(25)26)16-9-11-17(12-10-16)27-14-18(23)24/h9-12,15H,2-8,13-14H2,1H3,(H,23,24)(H,25,26) |
| InChIKey | IXRAKPMPRYEBSL-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.35 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|