C23H28N2O3S — CID 139781612
5-[[(3S)-1-benzylpyrrolidin-3-yl]sulfanylmethyl]-2-oxo-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindole-4-carboxylic acid (PubChem CID 139781612) has the molecular formula C23H28N2O3S and a molecular weight of 412.56 g/mol. Its IUPAC name is 5-[[(3S)-1-benzylpyrrolidin-3-yl]sulfanylmethyl]-2-oxo-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindole-4-carboxylic acid.
| Compound Name | 5-[[(3S)-1-benzylpyrrolidin-3-yl]sulfanylmethyl]-2-oxo-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindole-4-carboxylic acid |
|---|---|
| PubChem CID | 139781612 |
| Molecular Formula | C23H28N2O3S |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | 5-[[(3S)-1-benzylpyrrolidin-3-yl]sulfanylmethyl]-2-oxo-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindole-4-carboxylic acid |
| SMILES | O=C(O)C1=C2C(CS[C@H]3CCN(Cc4ccccc4)C3)CCCC2C2CC(=O)N12 |
| InChI | InChI=1S/C23H28N2O3S/c26-20-11-19-18-8-4-7-16(21(18)22(23(27)28)25(19)20)14-29-17-9-10-24(13-17)12-15-5-2-1-3-6-15/h1-3,5-6,16-19H,4,7-14H2,(H,27,28)/t16?,17-,18?,19?/m0/s1 |
| InChIKey | BGVDQDDIFVCTQI-JRVPFXOQSA-N |
| XLogP | 3.36 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |