C32H28N2O6 — CID 139781772
[4-[2-(4-butanoyloxyphenyl)-4,9-dioxo-1,6-dihydropyrido[2,3-g]quinolin-7-yl]phenyl] butanoate (PubChem CID 139781772) has the molecular formula C32H28N2O6 and a molecular weight of 536.58 g/mol. Its IUPAC name is [4-[2-(4-butanoyloxyphenyl)-4,9-dioxo-1,6-dihydropyrido[2,3-g]quinolin-7-yl]phenyl] butanoate.
| Compound Name | [4-[2-(4-butanoyloxyphenyl)-4,9-dioxo-1,6-dihydropyrido[2,3-g]quinolin-7-yl]phenyl] butanoate |
|---|---|
| PubChem CID | 139781772 |
| Molecular Formula | C32H28N2O6 |
| Molecular Weight | 536.58 g/mol |
| Exact Mass | 536.19 |
| IUPAC Name | [4-[2-(4-butanoyloxyphenyl)-4,9-dioxo-1,6-dihydropyrido[2,3-g]quinolin-7-yl]phenyl] butanoate |
| SMILES | CCCC(=O)Oc1ccc(-c2cc(=O)c3cc4[nH]c(-c5ccc(OC(=O)CCC)cc5)cc(=O)c4cc3[nH]2)cc1 |
| InChI | InChI=1S/C32H28N2O6/c1-3-5-31(37)39-21-11-7-19(8-12-21)25-17-29(35)23-16-28-24(15-27(23)33-25)30(36)18-26(34-28)20-9-13-22(14-10-20)40-32(38)6-4-2/h7-18H,3-6H2,1-2H3,(H,33,35)(H,34,36) |
| InChIKey | RKYHRBQQNNYETB-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 118.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.58 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|