C40H48N2O4 — CID 139781822
2,7-bis(4-octoxyphenyl)-1,6-dihydropyrido[2,3-g]quinoline-4,9-dione (PubChem CID 139781822) has the molecular formula C40H48N2O4 and a molecular weight of 620.83 g/mol. Its IUPAC name is 2,7-bis(4-octoxyphenyl)-1,6-dihydropyrido[2,3-g]quinoline-4,9-dione.
| Compound Name | 2,7-bis(4-octoxyphenyl)-1,6-dihydropyrido[2,3-g]quinoline-4,9-dione |
|---|---|
| PubChem CID | 139781822 |
| Molecular Formula | C40H48N2O4 |
| Molecular Weight | 620.83 g/mol |
| Exact Mass | 620.36 |
| IUPAC Name | 2,7-bis(4-octoxyphenyl)-1,6-dihydropyrido[2,3-g]quinoline-4,9-dione |
| SMILES | CCCCCCCCOc1ccc(-c2cc(=O)c3cc4[nH]c(-c5ccc(OCCCCCCCC)cc5)cc(=O)c4cc3[nH]2)cc1 |
| InChI | InChI=1S/C40H48N2O4/c1-3-5-7-9-11-13-23-45-31-19-15-29(16-20-31)35-27-39(43)33-26-38-34(25-37(33)41-35)40(44)28-36(42-38)30-17-21-32(22-18-30)46-24-14-12-10-8-6-4-2/h15-22,25-28H,3-14,23-24H2,1-2H3,(H,41,43)(H,42,44) |
| InChIKey | DCZKNBDXXBYKFW-UHFFFAOYSA-N |
| XLogP | 10.18 |
| TPSA | 84.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.83 |
| LogP ≤ 5 | 10.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|