C26H33Cl2FN4O8 — CID 139783828
[(2R,3R,4S)-2-[[[(2S)-2-(2,4-dichloro-5-methoxyphenoxy)propanoyl]amino]methyl]-5-(5-ethyl-2,4-dioxopyrimidin-1-yl)-4-fluorooxolan-3-yl] (2R)-2-amino-3-deuterio-3-methylbutanoate (PubChem CID 139783828) has the molecular formula C26H33Cl2FN4O8 and a molecular weight of 620.48 g/mol. Its IUPAC name is [(2R,3R,4S)-2-[[[(2S)-2-(2,4-dichloro-5-methoxyphenoxy)propanoyl]amino]methyl]-5-(5-ethyl-2,4-dioxopyrimidin-1-yl)-4-fluorooxolan-3-yl] (2R)-2-amino-3-deuterio-3-methylbutanoate.
| Compound Name | [(2R,3R,4S)-2-[[[(2S)-2-(2,4-dichloro-5-methoxyphenoxy)propanoyl]amino]methyl]-5-(5-ethyl-2,4-dioxopyrimidin-1-yl)-4-fluorooxolan-3-yl] (2R)-2-amino-3-deuterio-3-methylbutanoate |
|---|---|
| PubChem CID | 139783828 |
| Molecular Formula | C26H33Cl2FN4O8 |
| Molecular Weight | 620.48 g/mol |
| Exact Mass | 619.17 |
| IUPAC Name | [(2R,3R,4S)-2-[[[(2S)-2-(2,4-dichloro-5-methoxyphenoxy)propanoyl]amino]methyl]-5-(5-ethyl-2,4-dioxopyrimidin-1-yl)-4-fluorooxolan-3-yl] (2R)-2-amino-3-deuterio-3-methylbutanoate |
| SMILES | [2H]C(C)(C)[C@@H](N)C(=O)O[C@H]1[C@H](F)C(n2cc(CC)c(=O)[nH]c2=O)O[C@@H]1CNC(=O)[C@H](C)Oc1cc(OC)c(Cl)cc1Cl |
| InChI | InChI=1S/C26H33Cl2FN4O8/c1-6-13-10-33(26(37)32-23(13)35)24-19(29)21(41-25(36)20(30)11(2)3)18(40-24)9-31-22(34)12(4)39-17-8-16(38-5)14(27)7-15(17)28/h7-8,10-12,18-21,24H,6,9,30H2,1-5H3,(H,31,34)(H,32,35,37)/t12-,18+,19-,20+,21+,24?/m0/s1/i11D |
| InChIKey | GCGNTIIGCWRBRP-GLJUBEKFSA-N |
| XLogP | 2.13 |
| TPSA | 163.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.48 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |