C24H32N2O4 — CID 139785163
(7-methoxy-2-oxochromen-4-yl) N,N'-dicyclohexyl-N-methylcarbamimidate (PubChem CID 139785163) has the molecular formula C24H32N2O4 and a molecular weight of 412.53 g/mol. Its IUPAC name is (7-methoxy-2-oxochromen-4-yl) N,N'-dicyclohexyl-N-methylcarbamimidate.
| Compound Name | (7-methoxy-2-oxochromen-4-yl) N,N'-dicyclohexyl-N-methylcarbamimidate |
|---|---|
| PubChem CID | 139785163 |
| Molecular Formula | C24H32N2O4 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | (7-methoxy-2-oxochromen-4-yl) N,N'-dicyclohexyl-N-methylcarbamimidate |
| SMILES | COc1ccc2c(O/C(=N/C3CCCCC3)N(C)C3CCCCC3)cc(=O)oc2c1 |
| InChI | InChI=1S/C24H32N2O4/c1-26(18-11-7-4-8-12-18)24(25-17-9-5-3-6-10-17)30-22-16-23(27)29-21-15-19(28-2)13-14-20(21)22/h13-18H,3-12H2,1-2H3/b25-24+ |
| InChIKey | QSROBNZTNLMVOQ-OCOZRVBESA-N |
| XLogP | 5.13 |
| TPSA | 64.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|