C24H20F2N2O2 — CID 139785535
1-[4-[2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazol-4-yl]phenyl]-N-phenylmethoxyethanimine (PubChem CID 139785535) has the molecular formula C24H20F2N2O2 and a molecular weight of 406.43 g/mol. Its IUPAC name is 1-[4-[2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazol-4-yl]phenyl]-N-phenylmethoxyethanimine.
| Compound Name | 1-[4-[2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazol-4-yl]phenyl]-N-phenylmethoxyethanimine |
|---|---|
| PubChem CID | 139785535 |
| Molecular Formula | C24H20F2N2O2 |
| Molecular Weight | 406.43 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 1-[4-[2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazol-4-yl]phenyl]-N-phenylmethoxyethanimine |
| SMILES | CC(=NOCc1ccccc1)c1ccc(C2COC(c3c(F)cccc3F)=N2)cc1 |
| InChI | InChI=1S/C24H20F2N2O2/c1-16(28-30-14-17-6-3-2-4-7-17)18-10-12-19(13-11-18)22-15-29-24(27-22)23-20(25)8-5-9-21(23)26/h2-13,22H,14-15H2,1H3 |
| InChIKey | KUCRWIGUKXNRNZ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.43 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|