C34H25F3O4S2 — CID 139785757
[[4-(phenanthren-9-ylmethoxy)phenyl]-diphenyl-λ4-sulfanyl] trifluoromethanesulfonate (PubChem CID 139785757) has the molecular formula C34H25F3O4S2 and a molecular weight of 618.70 g/mol. Its IUPAC name is [[4-(phenanthren-9-ylmethoxy)phenyl]-diphenyl-λ4-sulfanyl] trifluoromethanesulfonate.
| Compound Name | [[4-(phenanthren-9-ylmethoxy)phenyl]-diphenyl-λ4-sulfanyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 139785757 |
| Molecular Formula | C34H25F3O4S2 |
| Molecular Weight | 618.70 g/mol |
| Exact Mass | 618.11 |
| IUPAC Name | [[4-(phenanthren-9-ylmethoxy)phenyl]-diphenyl-λ4-sulfanyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(OS(c1ccccc1)(c1ccccc1)c1ccc(OCc2cc3ccccc3c3ccccc23)cc1)C(F)(F)F |
| InChI | InChI=1S/C34H25F3O4S2/c35-34(36,37)43(38,39)41-42(28-12-3-1-4-13-28,29-14-5-2-6-15-29)30-21-19-27(20-22-30)40-24-26-23-25-11-7-8-16-31(25)33-18-10-9-17-32(26)33/h1-23H,24H2 |
| InChIKey | DYTULHFOSSAROC-UHFFFAOYSA-N |
| XLogP | 9.63 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.70 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|