C18H11FO3S — CID 162410304
3-fluoro-2-naphthalen-2-yl-1,4λ6-benzoxathiine 4,4-dioxide (PubChem CID 162410304) has the molecular formula C18H11FO3S and a molecular weight of 326.35 g/mol. Its IUPAC name is 3-fluoro-2-naphthalen-2-yl-1,4λ6-benzoxathiine 4,4-dioxide.
| Compound Name | 3-fluoro-2-naphthalen-2-yl-1,4λ6-benzoxathiine 4,4-dioxide |
|---|---|
| PubChem CID | 162410304 |
| Molecular Formula | C18H11FO3S |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | 3-fluoro-2-naphthalen-2-yl-1,4λ6-benzoxathiine 4,4-dioxide |
| SMILES | O=S1(=O)C(F)=C(c2ccc3ccccc3c2)Oc2ccccc21 |
| InChI | InChI=1S/C18H11FO3S/c19-18-17(14-10-9-12-5-1-2-6-13(12)11-14)22-15-7-3-4-8-16(15)23(18,20)21/h1-11H |
| InChIKey | WCXSBJVJRICNRQ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |