C27H23FO5S2 — CID 75040698
2-[1,1-bis(benzenesulfonyl)-1-fluorobut-3-en-2-yl]-6-methoxynaphthalene (PubChem CID 75040698) has the molecular formula C27H23FO5S2 and a molecular weight of 510.61 g/mol. Its IUPAC name is 2-[1,1-bis(benzenesulfonyl)-1-fluorobut-3-en-2-yl]-6-methoxynaphthalene.
| Compound Name | 2-[1,1-bis(benzenesulfonyl)-1-fluorobut-3-en-2-yl]-6-methoxynaphthalene |
|---|---|
| PubChem CID | 75040698 |
| Molecular Formula | C27H23FO5S2 |
| Molecular Weight | 510.61 g/mol |
| Exact Mass | 510.10 |
| IUPAC Name | 2-[1,1-bis(benzenesulfonyl)-1-fluorobut-3-en-2-yl]-6-methoxynaphthalene |
| SMILES | C=CC(c1ccc2cc(OC)ccc2c1)C(F)(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C27H23FO5S2/c1-3-26(22-15-14-21-19-23(33-2)17-16-20(21)18-22)27(28,34(29,30)24-10-6-4-7-11-24)35(31,32)25-12-8-5-9-13-25/h3-19,26H,1H2,2H3 |
| InChIKey | GJOMPTRBPBPQRN-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.61 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|