C23H21FO5S2 — CID 44519315
1-[(2S)-1,1-bis(benzenesulfonyl)-1-fluorobut-3-en-2-yl]-3-methoxybenzene (PubChem CID 44519315) has the molecular formula C23H21FO5S2 and a molecular weight of 460.55 g/mol. Its IUPAC name is 1-[(2S)-1,1-bis(benzenesulfonyl)-1-fluorobut-3-en-2-yl]-3-methoxybenzene.
| Compound Name | 1-[(2S)-1,1-bis(benzenesulfonyl)-1-fluorobut-3-en-2-yl]-3-methoxybenzene |
|---|---|
| PubChem CID | 44519315 |
| Molecular Formula | C23H21FO5S2 |
| Molecular Weight | 460.55 g/mol |
| Exact Mass | 460.08 |
| IUPAC Name | 1-[(2S)-1,1-bis(benzenesulfonyl)-1-fluorobut-3-en-2-yl]-3-methoxybenzene |
| SMILES | C=C[C@@H](c1cccc(OC)c1)C(F)(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C23H21FO5S2/c1-3-22(18-11-10-12-19(17-18)29-2)23(24,30(25,26)20-13-6-4-7-14-20)31(27,28)21-15-8-5-9-16-21/h3-17,22H,1H2,2H3/t22-/m0/s1 |
| InChIKey | VIYKROGVQHBBLS-QFIPXVFZSA-N |
| XLogP | 4.54 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.55 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|