C46H45F3O10S2 — CID 139785793
tert-butyl 2-[4-[[4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]-[4-(phenanthren-9-ylmethoxy)phenyl]-(trifluoromethylsulfonyloxy)-λ4-sulfanyl]phenoxy]acetate (PubChem CID 139785793) has the molecular formula C46H45F3O10S2 and a molecular weight of 878.98 g/mol. Its IUPAC name is tert-butyl 2-[4-[[4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]-[4-(phenanthren-9-ylmethoxy)phenyl]-(trifluoromethylsulfonyloxy)-λ4-sulfanyl]phenoxy]acetate.
| Compound Name | tert-butyl 2-[4-[[4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]-[4-(phenanthren-9-ylmethoxy)phenyl]-(trifluoromethylsulfonyloxy)-λ4-sulfanyl]phenoxy]acetate |
|---|---|
| PubChem CID | 139785793 |
| Molecular Formula | C46H45F3O10S2 |
| Molecular Weight | 878.98 g/mol |
| Exact Mass | 878.24 |
| IUPAC Name | tert-butyl 2-[4-[[4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]-[4-(phenanthren-9-ylmethoxy)phenyl]-(trifluoromethylsulfonyloxy)-λ4-sulfanyl]phenoxy]acetate |
| SMILES | CC(C)(C)OC(=O)COc1ccc(S(OS(=O)(=O)C(F)(F)F)(c2ccc(OCC(=O)OC(C)(C)C)cc2)c2ccc(OCc3cc4ccccc4c4ccccc34)cc2)cc1 |
| InChI | InChI=1S/C46H45F3O10S2/c1-44(2,3)57-42(50)29-55-34-17-23-37(24-18-34)60(59-61(52,53)46(47,48)49,38-25-19-35(20-26-38)56-30-43(51)58-45(4,5)6)36-21-15-33(16-22-36)54-28-32-27-31-11-7-8-12-39(31)41-14-10-9-13-40(32)41/h7-27H,28-30H2,1-6H3 |
| InChIKey | YPLRPTPHYDIWDD-UHFFFAOYSA-N |
| XLogP | 11.08 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 878.98 |
| LogP ≤ 5 | 11.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|