C31H29F3O6S2 — CID 22057219
[4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]-diphenylsulfanium;2-(trifluoromethyl)benzenesulfonate (PubChem CID 22057219) has the molecular formula C31H29F3O6S2 and a molecular weight of 618.70 g/mol. Its IUPAC name is [4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]-diphenylsulfanium;2-(trifluoromethyl)benzenesulfonate.
| Compound Name | [4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]-diphenylsulfanium;2-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 22057219 |
| Molecular Formula | C31H29F3O6S2 |
| Molecular Weight | 618.70 g/mol |
| Exact Mass | 618.14 |
| IUPAC Name | [4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]phenyl]-diphenylsulfanium;2-(trifluoromethyl)benzenesulfonate |
| SMILES | CC(C)(C)OC(=O)COc1ccc([S+](c2ccccc2)c2ccccc2)cc1.O=S(=O)([O-])c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C24H25O3S.C7H5F3O3S/c1-24(2,3)27-23(25)18-26-19-14-16-22(17-15-19)28(20-10-6-4-7-11-20)21-12-8-5-9-13-21;8-7(9,10)5-3-1-2-4-6(5)14(11,12)13/h4-17H,18H2,1-3H3;1-4H,(H,11,12,13)/q+1;/p-1 |
| InChIKey | AXKRRLTYNAOKGV-UHFFFAOYSA-M |
| XLogP | 7.11 |
| TPSA | 92.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.70 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|