C14H10ClN3O4 — CID 139785838
4-chloro-N-(2-methoxy-5-nitrophenyl)-1,3-benzoxazol-2-amine (PubChem CID 139785838) has the molecular formula C14H10ClN3O4 and a molecular weight of 319.70 g/mol. Its IUPAC name is 4-chloro-N-(2-methoxy-5-nitrophenyl)-1,3-benzoxazol-2-amine.
| Compound Name | 4-chloro-N-(2-methoxy-5-nitrophenyl)-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 139785838 |
| Molecular Formula | C14H10ClN3O4 |
| Molecular Weight | 319.70 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | 4-chloro-N-(2-methoxy-5-nitrophenyl)-1,3-benzoxazol-2-amine |
| SMILES | COc1ccc([N+](=O)[O-])cc1Nc1nc2c(Cl)cccc2o1 |
| InChI | InChI=1S/C14H10ClN3O4/c1-21-11-6-5-8(18(19)20)7-10(11)16-14-17-13-9(15)3-2-4-12(13)22-14/h2-7H,1H3,(H,16,17) |
| InChIKey | DXYQHZCOMKPIFH-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 90.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.70 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|