C17H19ClO7S — CID 139788612
2-[2-[chloromethoxy(methylsulfonylmethoxy)methyl]benzoyl]cyclohexane-1,3-dione (PubChem CID 139788612) has the molecular formula C17H19ClO7S and a molecular weight of 402.85 g/mol. Its IUPAC name is 2-[2-[chloromethoxy(methylsulfonylmethoxy)methyl]benzoyl]cyclohexane-1,3-dione.
| Compound Name | 2-[2-[chloromethoxy(methylsulfonylmethoxy)methyl]benzoyl]cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 139788612 |
| Molecular Formula | C17H19ClO7S |
| Molecular Weight | 402.85 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | 2-[2-[chloromethoxy(methylsulfonylmethoxy)methyl]benzoyl]cyclohexane-1,3-dione |
| SMILES | CS(=O)(=O)COC(OCCl)c1ccccc1C(=O)C1C(=O)CCCC1=O |
| InChI | InChI=1S/C17H19ClO7S/c1-26(22,23)10-25-17(24-9-18)12-6-3-2-5-11(12)16(21)15-13(19)7-4-8-14(15)20/h2-3,5-6,15,17H,4,7-10H2,1H3 |
| InChIKey | KABDGGYJJPRXTK-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.85 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|