C18H21N5 — CID 139791602
2-methyl-N-[phenyl-[3-(2H-tetrazol-5-yl)phenyl]methyl]propan-2-amine (PubChem CID 139791602) has the molecular formula C18H21N5 and a molecular weight of 307.40 g/mol. Its IUPAC name is 2-methyl-N-[phenyl-[3-(2H-tetrazol-5-yl)phenyl]methyl]propan-2-amine.
| Compound Name | 2-methyl-N-[phenyl-[3-(2H-tetrazol-5-yl)phenyl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 139791602 |
| Molecular Formula | C18H21N5 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | 2-methyl-N-[phenyl-[3-(2H-tetrazol-5-yl)phenyl]methyl]propan-2-amine |
| SMILES | CC(C)(C)NC(c1ccccc1)c1cccc(-c2nn[nH]n2)c1 |
| InChI | InChI=1S/C18H21N5/c1-18(2,3)19-16(13-8-5-4-6-9-13)14-10-7-11-15(12-14)17-20-22-23-21-17/h4-12,16,19H,1-3H3,(H,20,21,22,23) |
| InChIKey | SPLLKCQDSLCLNT-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |