C24H27NO2S — CID 139791676
N-[(2-methylsulfonylphenyl)-naphthalen-1-ylmethyl]cyclohexanamine (PubChem CID 139791676) has the molecular formula C24H27NO2S and a molecular weight of 393.55 g/mol. Its IUPAC name is N-[(2-methylsulfonylphenyl)-naphthalen-1-ylmethyl]cyclohexanamine.
| Compound Name | N-[(2-methylsulfonylphenyl)-naphthalen-1-ylmethyl]cyclohexanamine |
|---|---|
| PubChem CID | 139791676 |
| Molecular Formula | C24H27NO2S |
| Molecular Weight | 393.55 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | N-[(2-methylsulfonylphenyl)-naphthalen-1-ylmethyl]cyclohexanamine |
| SMILES | CS(=O)(=O)c1ccccc1C(NC1CCCCC1)c1cccc2ccccc12 |
| InChI | InChI=1S/C24H27NO2S/c1-28(26,27)23-17-8-7-15-22(23)24(25-19-12-3-2-4-13-19)21-16-9-11-18-10-5-6-14-20(18)21/h5-11,14-17,19,24-25H,2-4,12-13H2,1H3 |
| InChIKey | WMORWDWYXQGLHE-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.55 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |