About 4-pent-1-enoxybenzoyl chloride
4-pent-1-enoxybenzoyl chloride (PubChem CID 139792232) has the molecular formula C12H13ClO2
and a molecular weight of 224.69 g/mol. Its IUPAC name is 4-pent-1-enoxybenzoyl chloride.
Molecular Properties
| Compound Name | 4-pent-1-enoxybenzoyl chloride |
| PubChem CID | 139792232 |
| Molecular Formula | C12H13ClO2 |
| Molecular Weight | 224.69 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | 4-pent-1-enoxybenzoyl chloride |
| SMILES | CCCC=COc1ccc(C(=O)Cl)cc1 |
| InChI | InChI=1S/C12H13ClO2/c1-2-3-4-9-15-11-7-5-10(6-8-11)12(13)14/h4-9H,2-3H2,1H3 |
| InChIKey | SEPHHILNVNJIJM-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.69 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 4-pent-1-enoxybenzoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-pent-1-enoxybenzoyl chloride?
The IUPAC name of 4-pent-1-enoxybenzoyl chloride (CID 139792232) is 4-pent-1-enoxybenzoyl chloride.
What is the SMILES notation for 4-pent-1-enoxybenzoyl chloride?
The canonical SMILES for 4-pent-1-enoxybenzoyl chloride is CCCC=COc1ccc(C(=O)Cl)cc1.
What is the InChIKey of 4-pent-1-enoxybenzoyl chloride?
The InChIKey is SEPHHILNVNJIJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13ClO2/c1-2-3-4-9-15-11-7-5-10(6-8-11)12(13)14/h4-9H,2-3H2,1H3.
What are the key properties of 4-pent-1-enoxybenzoyl chloride?
4-pent-1-enoxybenzoyl chloride has a molecular weight of 224.69 g/mol, XLogP of 3.76, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-pent-1-enoxybenzoyl chloride is sourced from PubChem (CID 139792232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).