C16H13FN4OS — CID 139792323
2-[(Z)-2-cyano-1-(3-fluoroanilino)-2-pyridin-2-ylethenyl]sulfanylacetamide (PubChem CID 139792323) has the molecular formula C16H13FN4OS and a molecular weight of 328.37 g/mol. Its IUPAC name is 2-[(Z)-2-cyano-1-(3-fluoroanilino)-2-pyridin-2-ylethenyl]sulfanylacetamide.
| Compound Name | 2-[(Z)-2-cyano-1-(3-fluoroanilino)-2-pyridin-2-ylethenyl]sulfanylacetamide |
|---|---|
| PubChem CID | 139792323 |
| Molecular Formula | C16H13FN4OS |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | 2-[(Z)-2-cyano-1-(3-fluoroanilino)-2-pyridin-2-ylethenyl]sulfanylacetamide |
| SMILES | N#C/C(=C(/Nc1cccc(F)c1)SCC(N)=O)c1ccccn1 |
| InChI | InChI=1S/C16H13FN4OS/c17-11-4-3-5-12(8-11)21-16(23-10-15(19)22)13(9-18)14-6-1-2-7-20-14/h1-8,21H,10H2,(H2,19,22)/b16-13+ |
| InChIKey | RJHVHQVWZMQUDC-DTQAZKPQSA-N |
| XLogP | 2.74 |
| TPSA | 91.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|