C20H22N4OS — CID 139792331
2-[(Z)-1-anilino-2-cyano-2-pyridin-2-ylethenyl]sulfanyl-N,N-diethylacetamide (PubChem CID 139792331) has the molecular formula C20H22N4OS and a molecular weight of 366.49 g/mol. Its IUPAC name is 2-[(Z)-1-anilino-2-cyano-2-pyridin-2-ylethenyl]sulfanyl-N,N-diethylacetamide.
| Compound Name | 2-[(Z)-1-anilino-2-cyano-2-pyridin-2-ylethenyl]sulfanyl-N,N-diethylacetamide |
|---|---|
| PubChem CID | 139792331 |
| Molecular Formula | C20H22N4OS |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 2-[(Z)-1-anilino-2-cyano-2-pyridin-2-ylethenyl]sulfanyl-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CS/C(Nc1ccccc1)=C(\C#N)c1ccccn1 |
| InChI | InChI=1S/C20H22N4OS/c1-3-24(4-2)19(25)15-26-20(23-16-10-6-5-7-11-16)17(14-21)18-12-8-9-13-22-18/h5-13,23H,3-4,15H2,1-2H3/b20-17+ |
| InChIKey | FTVCMPHCNJVSJG-LVZFUZTISA-N |
| XLogP | 3.99 |
| TPSA | 69.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|