About ethyl 5-[[chloro(triphenyl)-λ5-phosphanyl]methyl]furan-2-carboxylate
ethyl 5-[[chloro(triphenyl)-λ5-phosphanyl]methyl]furan-2-carboxylate (PubChem CID 139792622) has the molecular formula C26H24ClO3P
and a molecular weight of 450.90 g/mol. Its IUPAC name is ethyl 5-[[chloro(triphenyl)-λ5-phosphanyl]methyl]furan-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-[[chloro(triphenyl)-λ5-phosphanyl]methyl]furan-2-carboxylate |
| PubChem CID | 139792622 |
| Molecular Formula | C26H24ClO3P |
| Molecular Weight | 450.90 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | ethyl 5-[[chloro(triphenyl)-λ5-phosphanyl]methyl]furan-2-carboxylate |
| SMILES | CCOC(=O)c1ccc(CP(Cl)(c2ccccc2)(c2ccccc2)c2ccccc2)o1 |
| InChI | InChI=1S/C26H24ClO3P/c1-2-29-26(28)25-19-18-21(30-25)20-31(27,22-12-6-3-7-13-22,23-14-8-4-9-15-23)24-16-10-5-11-17-24/h3-19H,2,20H2,1H3 |
| InChIKey | RMVVQQTXIKTSBP-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 450.90 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ethyl 5-[[chloro(triphenyl)-λ5-phosphanyl]methyl]furan-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-[[chloro(triphenyl)-λ5-phosphanyl]methyl]furan-2-carboxylate?
The IUPAC name of ethyl 5-[[chloro(triphenyl)-λ5-phosphanyl]methyl]furan-2-carboxylate (CID 139792622) is ethyl 5-[[chloro(triphenyl)-λ5-phosphanyl]methyl]furan-2-carboxylate.
What is the SMILES notation for ethyl 5-[[chloro(triphenyl)-λ5-phosphanyl]methyl]furan-2-carboxylate?
The canonical SMILES for ethyl 5-[[chloro(triphenyl)-λ5-phosphanyl]methyl]furan-2-carboxylate is CCOC(=O)c1ccc(CP(Cl)(c2ccccc2)(c2ccccc2)c2ccccc2)o1.
What is the InChIKey of ethyl 5-[[chloro(triphenyl)-λ5-phosphanyl]methyl]furan-2-carboxylate?
The InChIKey is RMVVQQTXIKTSBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H24ClO3P/c1-2-29-26(28)25-19-18-21(30-25)20-31(27,22-12-6-3-7-13-22,23-14-8-4-9-15-23)24-16-10-5-11-17-24/h3-19H,2,20H2,1H3.
What are the key properties of ethyl 5-[[chloro(triphenyl)-λ5-phosphanyl]methyl]furan-2-carboxylate?
ethyl 5-[[chloro(triphenyl)-λ5-phosphanyl]methyl]furan-2-carboxylate has a molecular weight of 450.90 g/mol, XLogP of 5.64, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-[[chloro(triphenyl)-λ5-phosphanyl]methyl]furan-2-carboxylate is sourced from PubChem (CID 139792622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).