C24H40O5 — CID 139797741
(2,5-dimethyl-4-nonanoyloxyfuran-3-yl) nonanoate (PubChem CID 139797741) has the molecular formula C24H40O5 and a molecular weight of 408.58 g/mol. Its IUPAC name is (2,5-dimethyl-4-nonanoyloxyfuran-3-yl) nonanoate.
| Compound Name | (2,5-dimethyl-4-nonanoyloxyfuran-3-yl) nonanoate |
|---|---|
| PubChem CID | 139797741 |
| Molecular Formula | C24H40O5 |
| Molecular Weight | 408.58 g/mol |
| Exact Mass | 408.29 |
| IUPAC Name | (2,5-dimethyl-4-nonanoyloxyfuran-3-yl) nonanoate |
| SMILES | CCCCCCCCC(=O)Oc1c(C)oc(C)c1OC(=O)CCCCCCCC |
| InChI | InChI=1S/C24H40O5/c1-5-7-9-11-13-15-17-21(25)28-23-19(3)27-20(4)24(23)29-22(26)18-16-14-12-10-8-6-2/h5-18H2,1-4H3 |
| InChIKey | GIFQBZJPEIGXPR-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.58 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|