C27H30F2N6O3 — CID 139801390
N-[2-[4-(2,4-difluorophenyl)piperazin-1-yl]ethyl]-N-(2-methyl-4,5,6,7-tetrahydroindazol-3-yl)-4-nitrobenzamide (PubChem CID 139801390) has the molecular formula C27H30F2N6O3 and a molecular weight of 524.57 g/mol. Its IUPAC name is N-[2-[4-(2,4-difluorophenyl)piperazin-1-yl]ethyl]-N-(2-methyl-4,5,6,7-tetrahydroindazol-3-yl)-4-nitrobenzamide.
| Compound Name | N-[2-[4-(2,4-difluorophenyl)piperazin-1-yl]ethyl]-N-(2-methyl-4,5,6,7-tetrahydroindazol-3-yl)-4-nitrobenzamide |
|---|---|
| PubChem CID | 139801390 |
| Molecular Formula | C27H30F2N6O3 |
| Molecular Weight | 524.57 g/mol |
| Exact Mass | 524.23 |
| IUPAC Name | N-[2-[4-(2,4-difluorophenyl)piperazin-1-yl]ethyl]-N-(2-methyl-4,5,6,7-tetrahydroindazol-3-yl)-4-nitrobenzamide |
| SMILES | Cn1nc2c(c1N(CCN1CCN(c3ccc(F)cc3F)CC1)C(=O)c1ccc([N+](=O)[O-])cc1)CCCC2 |
| InChI | InChI=1S/C27H30F2N6O3/c1-31-26(22-4-2-3-5-24(22)30-31)34(27(36)19-6-9-21(10-7-19)35(37)38)17-14-32-12-15-33(16-13-32)25-11-8-20(28)18-23(25)29/h6-11,18H,2-5,12-17H2,1H3 |
| InChIKey | GKNQOSYJDBLNAZ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 87.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.57 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|