C32H33FN6O3 — CID 139801472
N-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-4-nitro-N-(1-phenyl-4,5,6,7-tetrahydroindazol-3-yl)benzamide (PubChem CID 139801472) has the molecular formula C32H33FN6O3 and a molecular weight of 568.65 g/mol. Its IUPAC name is N-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-4-nitro-N-(1-phenyl-4,5,6,7-tetrahydroindazol-3-yl)benzamide.
| Compound Name | N-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-4-nitro-N-(1-phenyl-4,5,6,7-tetrahydroindazol-3-yl)benzamide |
|---|---|
| PubChem CID | 139801472 |
| Molecular Formula | C32H33FN6O3 |
| Molecular Weight | 568.65 g/mol |
| Exact Mass | 568.26 |
| IUPAC Name | N-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-4-nitro-N-(1-phenyl-4,5,6,7-tetrahydroindazol-3-yl)benzamide |
| SMILES | O=C(c1ccc([N+](=O)[O-])cc1)N(CCN1CCN(c2ccc(F)cc2)CC1)c1nn(-c2ccccc2)c2c1CCCC2 |
| InChI | InChI=1S/C32H33FN6O3/c33-25-12-16-26(17-13-25)36-21-18-35(19-22-36)20-23-37(32(40)24-10-14-28(15-11-24)39(41)42)31-29-8-4-5-9-30(29)38(34-31)27-6-2-1-3-7-27/h1-3,6-7,10-17H,4-5,8-9,18-23H2 |
| InChIKey | JNSKJUQHMGTPCV-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 87.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.65 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|