C28H31F3N6O3 — CID 139801587
N-(2-methyl-4,5,6,7-tetrahydroindazol-3-yl)-4-nitro-N-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]benzamide (PubChem CID 139801587) has the molecular formula C28H31F3N6O3 and a molecular weight of 556.59 g/mol. Its IUPAC name is N-(2-methyl-4,5,6,7-tetrahydroindazol-3-yl)-4-nitro-N-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]benzamide.
| Compound Name | N-(2-methyl-4,5,6,7-tetrahydroindazol-3-yl)-4-nitro-N-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 139801587 |
| Molecular Formula | C28H31F3N6O3 |
| Molecular Weight | 556.59 g/mol |
| Exact Mass | 556.24 |
| IUPAC Name | N-(2-methyl-4,5,6,7-tetrahydroindazol-3-yl)-4-nitro-N-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]benzamide |
| SMILES | Cn1nc2c(c1N(CCN1CCN(c3cccc(C(F)(F)F)c3)CC1)C(=O)c1ccc([N+](=O)[O-])cc1)CCCC2 |
| InChI | InChI=1S/C28H31F3N6O3/c1-33-26(24-7-2-3-8-25(24)32-33)36(27(38)20-9-11-22(12-10-20)37(39)40)18-15-34-13-16-35(17-14-34)23-6-4-5-21(19-23)28(29,30)31/h4-6,9-12,19H,2-3,7-8,13-18H2,1H3 |
| InChIKey | JTWKYIVUTZIUJV-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 87.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.59 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|