C36H62O — CID 139803797
4-(4-propan-2-ylcyclohexyl)-1-[3-[3-[4-(4-propan-2-ylcyclohexyl)cyclohexen-1-yl]propoxy]propyl]cyclohexene (PubChem CID 139803797) has the molecular formula C36H62O and a molecular weight of 510.89 g/mol. Its IUPAC name is 4-(4-propan-2-ylcyclohexyl)-1-[3-[3-[4-(4-propan-2-ylcyclohexyl)cyclohexen-1-yl]propoxy]propyl]cyclohexene.
| Compound Name | 4-(4-propan-2-ylcyclohexyl)-1-[3-[3-[4-(4-propan-2-ylcyclohexyl)cyclohexen-1-yl]propoxy]propyl]cyclohexene |
|---|---|
| PubChem CID | 139803797 |
| Molecular Formula | C36H62O |
| Molecular Weight | 510.89 g/mol |
| Exact Mass | 510.48 |
| IUPAC Name | 4-(4-propan-2-ylcyclohexyl)-1-[3-[3-[4-(4-propan-2-ylcyclohexyl)cyclohexen-1-yl]propoxy]propyl]cyclohexene |
| SMILES | CC(C)C1CCC(C2CC=C(CCCOCCCC3=CCC(C4CCC(C(C)C)CC4)CC3)CC2)CC1 |
| InChI | InChI=1S/C36H62O/c1-27(2)31-17-21-35(22-18-31)33-13-9-29(10-14-33)7-5-25-37-26-6-8-30-11-15-34(16-12-30)36-23-19-32(20-24-36)28(3)4/h9,11,27-28,31-36H,5-8,10,12-26H2,1-4H3 |
| InChIKey | FHAKDZUTHWPJJW-UHFFFAOYSA-N |
| XLogP | 10.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.89 |
| LogP ≤ 5 | 10.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|