About [2-(2,2,4,4-tetramethylpentan-3-yl)phenyl] hypochlorite
[2-(2,2,4,4-tetramethylpentan-3-yl)phenyl] hypochlorite (PubChem CID 139804425) has the molecular formula C15H23ClO
and a molecular weight of 254.80 g/mol. Its IUPAC name is [2-(2,2,4,4-tetramethylpentan-3-yl)phenyl] hypochlorite.
Analyze [2-(2,2,4,4-tetramethylpentan-3-yl)phenyl] hypochlorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2,2,4,4-tetramethylpentan-3-yl)phenyl] hypochlorite?
The IUPAC name of [2-(2,2,4,4-tetramethylpentan-3-yl)phenyl] hypochlorite (CID 139804425) is [2-(2,2,4,4-tetramethylpentan-3-yl)phenyl] hypochlorite.
What is the SMILES notation for [2-(2,2,4,4-tetramethylpentan-3-yl)phenyl] hypochlorite?
The canonical SMILES for [2-(2,2,4,4-tetramethylpentan-3-yl)phenyl] hypochlorite is CC(C)(C)C(c1ccccc1OCl)C(C)(C)C.
What is the InChIKey of [2-(2,2,4,4-tetramethylpentan-3-yl)phenyl] hypochlorite?
The InChIKey is MRIHOJVEKMJAHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23ClO/c1-14(2,3)13(15(4,5)6)11-9-7-8-10-12(11)17-16/h7-10,13H,1-6H3.
What are the key properties of [2-(2,2,4,4-tetramethylpentan-3-yl)phenyl] hypochlorite?
[2-(2,2,4,4-tetramethylpentan-3-yl)phenyl] hypochlorite has a molecular weight of 254.80 g/mol, XLogP of 5.39, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,2,4,4-tetramethylpentan-3-yl)phenyl] hypochlorite is sourced from PubChem (CID 139804425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).