C27H40N2O2 — CID 102310465
1,3-bis[(1R)-1-(2-methoxyphenyl)-2,2-dimethylpropyl]imidazolidine (PubChem CID 102310465) has the molecular formula C27H40N2O2 and a molecular weight of 424.63 g/mol. Its IUPAC name is 1,3-bis[(1R)-1-(2-methoxyphenyl)-2,2-dimethylpropyl]imidazolidine.
| Compound Name | 1,3-bis[(1R)-1-(2-methoxyphenyl)-2,2-dimethylpropyl]imidazolidine |
|---|---|
| PubChem CID | 102310465 |
| Molecular Formula | C27H40N2O2 |
| Molecular Weight | 424.63 g/mol |
| Exact Mass | 424.31 |
| IUPAC Name | 1,3-bis[(1R)-1-(2-methoxyphenyl)-2,2-dimethylpropyl]imidazolidine |
| SMILES | COc1ccccc1[C@H](N1CCN([C@@H](c2ccccc2OC)C(C)(C)C)C1)C(C)(C)C |
| InChI | InChI=1S/C27H40N2O2/c1-26(2,3)24(20-13-9-11-15-22(20)30-7)28-17-18-29(19-28)25(27(4,5)6)21-14-10-12-16-23(21)31-8/h9-16,24-25H,17-19H2,1-8H3/t24-,25-/m0/s1 |
| InChIKey | JDKILOCRVIGQHK-DQEYMECFSA-N |
| XLogP | 6.15 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.63 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |