C13H19NOS2 — CID 154510233
[1-(2-methoxyphenyl)-2,2-dimethylpropyl]carbamodithioic acid (PubChem CID 154510233) has the molecular formula C13H19NOS2 and a molecular weight of 269.44 g/mol. Its IUPAC name is [1-(2-methoxyphenyl)-2,2-dimethylpropyl]carbamodithioic acid.
| Compound Name | [1-(2-methoxyphenyl)-2,2-dimethylpropyl]carbamodithioic acid |
|---|---|
| PubChem CID | 154510233 |
| Molecular Formula | C13H19NOS2 |
| Molecular Weight | 269.44 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | [1-(2-methoxyphenyl)-2,2-dimethylpropyl]carbamodithioic acid |
| SMILES | COc1ccccc1C(NC(=S)S)C(C)(C)C |
| InChI | InChI=1S/C13H19NOS2/c1-13(2,3)11(14-12(16)17)9-7-5-6-8-10(9)15-4/h5-8,11H,1-4H3,(H2,14,16,17) |
| InChIKey | UYZYXMJMWAJTTQ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.44 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|