C16H22ClNO2S — CID 88706950
O-(2-chloroprop-2-enyl) N-[1-(2-methoxyphenyl)-2,2-dimethylpropyl]carbamothioate (PubChem CID 88706950) has the molecular formula C16H22ClNO2S and a molecular weight of 327.88 g/mol. Its IUPAC name is O-(2-chloroprop-2-enyl) N-[1-(2-methoxyphenyl)-2,2-dimethylpropyl]carbamothioate.
| Compound Name | O-(2-chloroprop-2-enyl) N-[1-(2-methoxyphenyl)-2,2-dimethylpropyl]carbamothioate |
|---|---|
| PubChem CID | 88706950 |
| Molecular Formula | C16H22ClNO2S |
| Molecular Weight | 327.88 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | O-(2-chloroprop-2-enyl) N-[1-(2-methoxyphenyl)-2,2-dimethylpropyl]carbamothioate |
| SMILES | C=C(Cl)COC(=S)NC(c1ccccc1OC)C(C)(C)C |
| InChI | InChI=1S/C16H22ClNO2S/c1-11(17)10-20-15(21)18-14(16(2,3)4)12-8-6-7-9-13(12)19-5/h6-9,14H,1,10H2,2-5H3,(H,18,21) |
| InChIKey | IJMKMWPUIYXNGY-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.88 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|