C11H24O3Si — CID 139805329
(3S)-3-[tert-butyl(dimethyl)silyl]oxypentanoic acid (PubChem CID 139805329) has the molecular formula C11H24O3Si and a molecular weight of 232.40 g/mol. Its IUPAC name is (3S)-3-[tert-butyl(dimethyl)silyl]oxypentanoic acid.
| Compound Name | (3S)-3-[tert-butyl(dimethyl)silyl]oxypentanoic acid |
|---|---|
| PubChem CID | 139805329 |
| Molecular Formula | C11H24O3Si |
| Molecular Weight | 232.40 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | (3S)-3-[tert-butyl(dimethyl)silyl]oxypentanoic acid |
| SMILES | CC[C@@H](CC(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C11H24O3Si/c1-7-9(8-10(12)13)14-15(5,6)11(2,3)4/h9H,7-8H2,1-6H3,(H,12,13)/t9-/m0/s1 |
| InChIKey | ATYNPRAOTKBRBI-VIFPVBQESA-N |
| XLogP | 3.26 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.40 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|