About O-(oxiran-2-ylmethyl) 12-methyloctadec-2-enethioate
O-(oxiran-2-ylmethyl) 12-methyloctadec-2-enethioate (PubChem CID 139807445) has the molecular formula C22H40O2S
and a molecular weight of 368.63 g/mol. Its IUPAC name is O-(oxiran-2-ylmethyl) 12-methyloctadec-2-enethioate.
Molecular Properties
| Compound Name | O-(oxiran-2-ylmethyl) 12-methyloctadec-2-enethioate |
| PubChem CID | 139807445 |
| Molecular Formula | C22H40O2S |
| Molecular Weight | 368.63 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | O-(oxiran-2-ylmethyl) 12-methyloctadec-2-enethioate |
| SMILES | CCCCCCC(C)CCCCCCCCC=CC(=S)OCC1CO1 |
| InChI | InChI=1S/C22H40O2S/c1-3-4-5-12-15-20(2)16-13-10-8-6-7-9-11-14-17-22(25)24-19-21-18-23-21/h14,17,20-21H,3-13,15-16,18-19H2,1-2H3 |
| InChIKey | QORCKQFKHQUGND-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.63 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze O-(oxiran-2-ylmethyl) 12-methyloctadec-2-enethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-(oxiran-2-ylmethyl) 12-methyloctadec-2-enethioate?
The IUPAC name of O-(oxiran-2-ylmethyl) 12-methyloctadec-2-enethioate (CID 139807445) is O-(oxiran-2-ylmethyl) 12-methyloctadec-2-enethioate.
What is the SMILES notation for O-(oxiran-2-ylmethyl) 12-methyloctadec-2-enethioate?
The canonical SMILES for O-(oxiran-2-ylmethyl) 12-methyloctadec-2-enethioate is CCCCCCC(C)CCCCCCCCC=CC(=S)OCC1CO1.
What is the InChIKey of O-(oxiran-2-ylmethyl) 12-methyloctadec-2-enethioate?
The InChIKey is QORCKQFKHQUGND-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H40O2S/c1-3-4-5-12-15-20(2)16-13-10-8-6-7-9-11-14-17-22(25)24-19-21-18-23-21/h14,17,20-21H,3-13,15-16,18-19H2,1-2H3.
What are the key properties of O-(oxiran-2-ylmethyl) 12-methyloctadec-2-enethioate?
O-(oxiran-2-ylmethyl) 12-methyloctadec-2-enethioate has a molecular weight of 368.63 g/mol, XLogP of 7.01, 17 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for O-(oxiran-2-ylmethyl) 12-methyloctadec-2-enethioate is sourced from PubChem (CID 139807445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).