C27H40F2N2O — CID 139808152
2-[4-[(3R)-3-fluorononyl]phenyl]-5-[(3S)-3-fluorooctoxy]pyrimidine (PubChem CID 139808152) has the molecular formula C27H40F2N2O and a molecular weight of 446.63 g/mol. Its IUPAC name is 2-[4-[(3R)-3-fluorononyl]phenyl]-5-[(3S)-3-fluorooctoxy]pyrimidine.
| Compound Name | 2-[4-[(3R)-3-fluorononyl]phenyl]-5-[(3S)-3-fluorooctoxy]pyrimidine |
|---|---|
| PubChem CID | 139808152 |
| Molecular Formula | C27H40F2N2O |
| Molecular Weight | 446.63 g/mol |
| Exact Mass | 446.31 |
| IUPAC Name | 2-[4-[(3R)-3-fluorononyl]phenyl]-5-[(3S)-3-fluorooctoxy]pyrimidine |
| SMILES | CCCCCC[C@@H](F)CCc1ccc(-c2ncc(OCC[C@@H](F)CCCCC)cn2)cc1 |
| InChI | InChI=1S/C27H40F2N2O/c1-3-5-7-9-11-24(28)17-14-22-12-15-23(16-13-22)27-30-20-26(21-31-27)32-19-18-25(29)10-8-6-4-2/h12-13,15-16,20-21,24-25H,3-11,14,17-19H2,1-2H3/t24-,25+/m1/s1 |
| InChIKey | SNPBDNBYEBHMOW-RPBOFIJWSA-N |
| XLogP | 8.07 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.63 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|