C29H44F2N2O — CID 18696843
2-(4-decylphenyl)-5-(3,6-difluorononoxy)pyrimidine (PubChem CID 18696843) has the molecular formula C29H44F2N2O and a molecular weight of 474.68 g/mol. Its IUPAC name is 2-(4-decylphenyl)-5-(3,6-difluorononoxy)pyrimidine.
| Compound Name | 2-(4-decylphenyl)-5-(3,6-difluorononoxy)pyrimidine |
|---|---|
| PubChem CID | 18696843 |
| Molecular Formula | C29H44F2N2O |
| Molecular Weight | 474.68 g/mol |
| Exact Mass | 474.34 |
| IUPAC Name | 2-(4-decylphenyl)-5-(3,6-difluorononoxy)pyrimidine |
| SMILES | CCCCCCCCCCc1ccc(-c2ncc(OCCC(F)CCC(F)CCC)cn2)cc1 |
| InChI | InChI=1S/C29H44F2N2O/c1-3-5-6-7-8-9-10-11-13-24-14-16-25(17-15-24)29-32-22-28(23-33-29)34-21-20-27(31)19-18-26(30)12-4-2/h14-17,22-23,26-27H,3-13,18-21H2,1-2H3 |
| InChIKey | LGKPCCPWLHAORC-UHFFFAOYSA-N |
| XLogP | 8.85 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.68 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|