C28H17F6NO4S2 — CID 139810102
4-[4-[2-[2-(4-carboxyphenyl)-5-methyl-1,3-thiazol-4-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-methylthiophen-2-yl]benzoic acid (PubChem CID 139810102) has the molecular formula C28H17F6NO4S2 and a molecular weight of 609.57 g/mol. Its IUPAC name is 4-[4-[2-[2-(4-carboxyphenyl)-5-methyl-1,3-thiazol-4-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-methylthiophen-2-yl]benzoic acid.
| Compound Name | 4-[4-[2-[2-(4-carboxyphenyl)-5-methyl-1,3-thiazol-4-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-methylthiophen-2-yl]benzoic acid |
|---|---|
| PubChem CID | 139810102 |
| Molecular Formula | C28H17F6NO4S2 |
| Molecular Weight | 609.57 g/mol |
| Exact Mass | 609.05 |
| IUPAC Name | 4-[4-[2-[2-(4-carboxyphenyl)-5-methyl-1,3-thiazol-4-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-methylthiophen-2-yl]benzoic acid |
| SMILES | Cc1sc(-c2ccc(C(=O)O)cc2)cc1C1=C(c2nc(-c3ccc(C(=O)O)cc3)sc2C)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C28H17F6NO4S2/c1-12-18(11-19(40-12)14-3-7-16(8-4-14)24(36)37)20-21(27(31,32)28(33,34)26(20,29)30)22-13(2)41-23(35-22)15-5-9-17(10-6-15)25(38)39/h3-11H,1-2H3,(H,36,37)(H,38,39) |
| InChIKey | XBAWMVPMDXGUBM-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.57 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|