C29H28F3NO3S — CID 139811261
(11-benzyl-1-phenyl-11-azatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6-triene-9-yl)methyl trifluoromethanesulfonate (PubChem CID 139811261) has the molecular formula C29H28F3NO3S and a molecular weight of 527.61 g/mol. Its IUPAC name is (11-benzyl-1-phenyl-11-azatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6-triene-9-yl)methyl trifluoromethanesulfonate.
| Compound Name | (11-benzyl-1-phenyl-11-azatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6-triene-9-yl)methyl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 139811261 |
| Molecular Formula | C29H28F3NO3S |
| Molecular Weight | 527.61 g/mol |
| Exact Mass | 527.17 |
| IUPAC Name | (11-benzyl-1-phenyl-11-azatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6-triene-9-yl)methyl trifluoromethanesulfonate |
| SMILES | O=S(=O)(OCC12CN(Cc3ccccc3)CC1C1(c3ccccc3)CCC2c2ccccc21)C(F)(F)F |
| InChI | InChI=1S/C29H28F3NO3S/c30-29(31,32)37(34,35)36-20-27-19-33(17-21-9-3-1-4-10-21)18-26(27)28(22-11-5-2-6-12-22)16-15-24(27)23-13-7-8-14-25(23)28/h1-14,24,26H,15-20H2 |
| InChIKey | MERJUECGQHJIMG-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.61 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|