C22H21N3O2S — CID 139812473
methyl 3-propyl-2-(quinolin-2-ylmethylsulfanyl)benzimidazole-5-carboxylate (PubChem CID 139812473) has the molecular formula C22H21N3O2S and a molecular weight of 391.50 g/mol. Its IUPAC name is methyl 3-propyl-2-(quinolin-2-ylmethylsulfanyl)benzimidazole-5-carboxylate.
| Compound Name | methyl 3-propyl-2-(quinolin-2-ylmethylsulfanyl)benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 139812473 |
| Molecular Formula | C22H21N3O2S |
| Molecular Weight | 391.50 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | methyl 3-propyl-2-(quinolin-2-ylmethylsulfanyl)benzimidazole-5-carboxylate |
| SMILES | CCCn1c(SCc2ccc3ccccc3n2)nc2ccc(C(=O)OC)cc21 |
| InChI | InChI=1S/C22H21N3O2S/c1-3-12-25-20-13-16(21(26)27-2)9-11-19(20)24-22(25)28-14-17-10-8-15-6-4-5-7-18(15)23-17/h4-11,13H,3,12,14H2,1-2H3 |
| InChIKey | CVWRKNBBDUNCGB-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.50 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |