About 1-fluoro-4-(4-propylcyclopenta-1,4-dien-1-yl)benzene
1-fluoro-4-(4-propylcyclopenta-1,4-dien-1-yl)benzene (PubChem CID 139812660) has the molecular formula C14H15F
and a molecular weight of 202.27 g/mol. Its IUPAC name is 1-fluoro-4-(4-propylcyclopenta-1,4-dien-1-yl)benzene.
Analyze 1-fluoro-4-(4-propylcyclopenta-1,4-dien-1-yl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-4-(4-propylcyclopenta-1,4-dien-1-yl)benzene?
The IUPAC name of 1-fluoro-4-(4-propylcyclopenta-1,4-dien-1-yl)benzene (CID 139812660) is 1-fluoro-4-(4-propylcyclopenta-1,4-dien-1-yl)benzene.
What is the SMILES notation for 1-fluoro-4-(4-propylcyclopenta-1,4-dien-1-yl)benzene?
The canonical SMILES for 1-fluoro-4-(4-propylcyclopenta-1,4-dien-1-yl)benzene is CCCC1=CC(c2ccc(F)cc2)=CC1.
What is the InChIKey of 1-fluoro-4-(4-propylcyclopenta-1,4-dien-1-yl)benzene?
The InChIKey is HXWOQVVOLVDINT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15F/c1-2-3-11-4-5-13(10-11)12-6-8-14(15)9-7-12/h5-10H,2-4H2,1H3.
What are the key properties of 1-fluoro-4-(4-propylcyclopenta-1,4-dien-1-yl)benzene?
1-fluoro-4-(4-propylcyclopenta-1,4-dien-1-yl)benzene has a molecular weight of 202.27 g/mol, XLogP of 4.34, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-4-(4-propylcyclopenta-1,4-dien-1-yl)benzene is sourced from PubChem (CID 139812660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).