C17H19F4NO — CID 139813353
3-fluoro-4-[4-[1-(trifluoromethoxy)propyl]cyclohexyl]benzonitrile (PubChem CID 139813353) has the molecular formula C17H19F4NO and a molecular weight of 329.34 g/mol. Its IUPAC name is 3-fluoro-4-[4-[1-(trifluoromethoxy)propyl]cyclohexyl]benzonitrile.
| Compound Name | 3-fluoro-4-[4-[1-(trifluoromethoxy)propyl]cyclohexyl]benzonitrile |
|---|---|
| PubChem CID | 139813353 |
| Molecular Formula | C17H19F4NO |
| Molecular Weight | 329.34 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 3-fluoro-4-[4-[1-(trifluoromethoxy)propyl]cyclohexyl]benzonitrile |
| SMILES | CCC(OC(F)(F)F)C1CCC(c2ccc(C#N)cc2F)CC1 |
| InChI | InChI=1S/C17H19F4NO/c1-2-16(23-17(19,20)21)13-6-4-12(5-7-13)14-8-3-11(10-22)9-15(14)18/h3,8-9,12-13,16H,2,4-7H2,1H3 |
| InChIKey | XGRFLABWKFIBEC-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.34 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |