C13H14FNO3 — CID 70380354
4-(5-ethoxy-1,3-dioxan-2-yl)-3-fluorobenzonitrile (PubChem CID 70380354) has the molecular formula C13H14FNO3 and a molecular weight of 251.26 g/mol. Its IUPAC name is 4-(5-ethoxy-1,3-dioxan-2-yl)-3-fluorobenzonitrile.
| Compound Name | 4-(5-ethoxy-1,3-dioxan-2-yl)-3-fluorobenzonitrile |
|---|---|
| PubChem CID | 70380354 |
| Molecular Formula | C13H14FNO3 |
| Molecular Weight | 251.26 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | 4-(5-ethoxy-1,3-dioxan-2-yl)-3-fluorobenzonitrile |
| SMILES | CCOC1COC(c2ccc(C#N)cc2F)OC1 |
| InChI | InChI=1S/C13H14FNO3/c1-2-16-10-7-17-13(18-8-10)11-4-3-9(6-15)5-12(11)14/h3-5,10,13H,2,7-8H2,1H3 |
| InChIKey | VOCMPJUGZDVOFW-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.26 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |