About 1-methoxy-3,4-dihydro-1H-isochromene-6-carbonitrile
1-methoxy-3,4-dihydro-1H-isochromene-6-carbonitrile (PubChem CID 154193215) has the molecular formula C11H11NO2
and a molecular weight of 189.21 g/mol. Its IUPAC name is 1-methoxy-3,4-dihydro-1H-isochromene-6-carbonitrile.
Molecular Properties
| Compound Name | 1-methoxy-3,4-dihydro-1H-isochromene-6-carbonitrile |
| PubChem CID | 154193215 |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | 1-methoxy-3,4-dihydro-1H-isochromene-6-carbonitrile |
| SMILES | COC1OCCc2cc(C#N)ccc21 |
| InChI | InChI=1S/C11H11NO2/c1-13-11-10-3-2-8(7-12)6-9(10)4-5-14-11/h2-3,6,11H,4-5H2,1H3 |
| InChIKey | YSTKWKYTPYDVAT-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methoxy-3,4-dihydro-1H-isochromene-6-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-3,4-dihydro-1H-isochromene-6-carbonitrile?
The IUPAC name of 1-methoxy-3,4-dihydro-1H-isochromene-6-carbonitrile (CID 154193215) is 1-methoxy-3,4-dihydro-1H-isochromene-6-carbonitrile.
What is the SMILES notation for 1-methoxy-3,4-dihydro-1H-isochromene-6-carbonitrile?
The canonical SMILES for 1-methoxy-3,4-dihydro-1H-isochromene-6-carbonitrile is COC1OCCc2cc(C#N)ccc21.
What is the InChIKey of 1-methoxy-3,4-dihydro-1H-isochromene-6-carbonitrile?
The InChIKey is YSTKWKYTPYDVAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO2/c1-13-11-10-3-2-8(7-12)6-9(10)4-5-14-11/h2-3,6,11H,4-5H2,1H3.
What are the key properties of 1-methoxy-3,4-dihydro-1H-isochromene-6-carbonitrile?
1-methoxy-3,4-dihydro-1H-isochromene-6-carbonitrile has a molecular weight of 189.21 g/mol, XLogP of 1.78, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-3,4-dihydro-1H-isochromene-6-carbonitrile is sourced from PubChem (CID 154193215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).