C11H11NO2 — CID 154193215
1-methoxy-3,4-dihydro-1H-isochromene-6-carbonitrile (PubChem CID 154193215) has the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. Its IUPAC name is 1-methoxy-3,4-dihydro-1H-isochromene-6-carbonitrile.
| Compound Name | 1-methoxy-3,4-dihydro-1H-isochromene-6-carbonitrile |
|---|---|
| PubChem CID | 154193215 |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | 1-methoxy-3,4-dihydro-1H-isochromene-6-carbonitrile |
| SMILES | COC1OCCc2cc(C#N)ccc21 |
| InChI | InChI=1S/C11H11NO2/c1-13-11-10-3-2-8(7-12)6-9(10)4-5-14-11/h2-3,6,11H,4-5H2,1H3 |
| InChIKey | YSTKWKYTPYDVAT-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |